What is the IUPAC name of the compound represented by the structure CH3-CH(CH3)-CH2-CH(NH2)-CH3?

Study for the NCEA Level 2 Organic Chemistry Exam. Review key concepts with flashcards and multiple choice questions, each with detailed explanations. Get prepared for your exam success!

Multiple Choice

What is the IUPAC name of the compound represented by the structure CH3-CH(CH3)-CH2-CH(NH2)-CH3?

Explanation:
To determine the correct IUPAC name for the compound CH3-CH(CH3)-CH2-CH(NH2)-CH3, it is essential to identify the longest carbon chain and any substituents attached to that chain. In this structure, we can observe that the longest continuous carbon chain contains five carbon atoms, which can be considered a pentane. Among these carbons, there is an amino group (-NH2) attached to the fourth carbon of the chain. Additionally, a methyl group (CH3) is attached to the second carbon. When naming the compound, it is crucial to number the carbon chain in such a way that the amino group receives the lowest possible number. In this case, numbering the chain from one end to the other gives us the amino group at position four. Considering the presence of the methyl group at position two, the compound can be named as 2-amino-4-methylpentane. This reflects the positions of the amino group and the methyl substituent accurately. The structure and substituents confirm that option B is indeed the correct IUPAC name for the compound.

To determine the correct IUPAC name for the compound CH3-CH(CH3)-CH2-CH(NH2)-CH3, it is essential to identify the longest carbon chain and any substituents attached to that chain.

In this structure, we can observe that the longest continuous carbon chain contains five carbon atoms, which can be considered a pentane. Among these carbons, there is an amino group (-NH2) attached to the fourth carbon of the chain. Additionally, a methyl group (CH3) is attached to the second carbon.

When naming the compound, it is crucial to number the carbon chain in such a way that the amino group receives the lowest possible number. In this case, numbering the chain from one end to the other gives us the amino group at position four. Considering the presence of the methyl group at position two, the compound can be named as 2-amino-4-methylpentane. This reflects the positions of the amino group and the methyl substituent accurately.

The structure and substituents confirm that option B is indeed the correct IUPAC name for the compound.

Subscribe

Get the latest from Passetra

You can unsubscribe at any time. Read our privacy policy